Вопрос Какие из приведенных соединений относятся к основным оксидам: а no, б MgO, в BaO2, г Na2O, д Mn2O7?




Скачать 128.01 Kb.
НазваниеВопрос Какие из приведенных соединений относятся к основным оксидам: а no, б MgO, в BaO2, г Na2O, д Mn2O7?
Дата публикации01.03.2014
Размер128.01 Kb.
ТипВопрос
zadocs.ru > Математика > Вопрос
ХИ - К/р тест

1 вариант

Задание 1

Вопрос 1. Какие из приведенных соединений относятся к основным оксидам: а)NO,

б)MgO, в)BaO2, г)Na2O, д) Mn2O7?

1. а, д

2. в, г

3. б, г

4. в, д

5. а, б

Вопрос 2.С какими из перечисленных веществ будет взаимодействовать оксид кальция:

а)H2O, б)PbO, в)CO2, г)NaCl, д)HCl?

1. а, в

2. а, в, д

3. б, в, г

4. в, г, д

5. а, г, д

Вопрос 3. Какие из приведенных веществ относятся к кислотным оксидам: а)CrO3, б)CO,

в)N2O5, г)BaO, д)SnO?

1. а, в

2. а, б, в

3. в, д

4. а, б

5. б, в, г

Вопрос 4. С какими из перечисленных веществ будет взаимодействовать оксид серы (VI):

а)Ba(OH)2, б)KI, в)H2O, г)CaO, д)H2S?

1. а, в, г

2. б, в, г

3. в, г, д

4. а, в, д

5. а, б, д

Вопрос 5. Какие из перечисленных оксидов относятся к несолеобразующим: а)CoO,

б)N2O, в)CO, г)N2O5, д)NO

1. а, б, г

2. б, в, д

3. б, в, г

4. в, г, д

5. а, в, д

Задание 2

Вопрос 1. Какие из перечисленных веществ относятся к основаниям: а)KOH, б)CH3OH,

в)Ge(OH)4, г)Cu(OH)2, д)Sr(OH)2?

1. а, в, г

2. а, г, д

3. б, в, г

4. в, г, д

5. а, в, д

Вопрос 2. Какие из перечисленных оксидов при взаимодействии с водой дают растворимые

основания (щелочи): а)BaO, б)CuO, в)Li2O, г)MgO, д)Al2O3?

1. а, в

2. а, в, г

3. в, г

4. б, г, д

5. б, д

Вопрос 3. Какие из перечисленных гидроксидов при нагревании разлагаются на оксид и воду:

а)KOH, б)Ca(OH)2, в)Ba(OH)2, г)Fe(OH)3, д)Al(OH)3?

1. а, б, в

2. б, г, д

3. г, д

4. б, в, г

5. в, г

Вопрос 4. С какими из перечисленных веществ будет взаимодействовать гидроксид натрия:

а)HNO3, б)BaSO4, в)SO2, г)FeO, д)CuCl2?

1. а, в, д

2. в, д

3. а, б, в

4. в, г, д

5. б, г

Вопрос 5. С какими из перечисленных веществ будет взаимодействовать гидроксид меди:

а)HCl, б)BaCl2, в)CO2, г)H2SO4, д)KCl?

1. а, б

2. а, г

3. в, г

4. а, в, г

5. в, г, д

Задание 3

Вопрос 1. Какие из перечисленных веществ относятся к амфотерным оксидам:

а)CoO, б)ZnO,, в)Cr2O3, г)MgO, д)BeO?

1. а, б, в

2. б, в, г

3. в, г, д

4. б, г, д

5. б, в, д

Вопрос 2. С какими из перечисленных веществ будет взаимодействовать оксид алюминия:

а)NaOH, б)CO2, в)HCl, г)Li2O, д)SiO2?

1. а, в, г, д

2. а, б, в, д

3. б, в, г

4. в, г. д

5. а, б, г, д

Вопрос 3. Какие из перечисленных веществ относятся к амфотерным гидроксидам:

а)Fe(OH)2, б)Al(OH)3, в)Ca(OH)2, г)Zn(OH)2 д)Ni(OH)2?

1. а, б, в

2. б, г, д

3. в, г

4. г, д

5. б, г

Вопрос 4. С какими из перечисленных веществ будет взаимодействовать гидроксид

хрома (III): а)SO2, б)NaOH, в)H2SO4, г)KNO3, д)Cu(OH)2?

1. а, б,

2. б, в

3. б, в, д

4. в, г, д

5. б, д

Вопрос 5. Что будет происходить с гидроксидом цинка при нагревании? Напишите

соответствующее уравнение реакции. Укажите сумму коэффициентов в этом уравнении:

1. 3

2. 4

3. 5

4. 6

5. 7

Задание 4.

Вопрос 1. Укажите формулы хлорной, марганцовистой, ортофосфорной кислот:

1. HClO, H2MnO4, HPO3

2. HCl, HMnO, H3PO4

3. HClO4, H2MnO4, H3PO4

4. HClO3, H2MnO4, H3PO4

5. HClO4, HMnO4, HPO2

Вопрос 2. Укажите оксиды, при взаимодействии которых с водой образуются кислоты:

а)NO, б)SO2, в)SiO2, г)CaO, д) CrO3.

1. а, б, в

2. б, в

3. в, г, д

4. б, д

5. в, д

Вопрос 3. С какими из перечисленных веществ будет взаимодействовать разбавленная серная

кислота: а)MgO, б)CO2, в)CaCl2 г)Al(OH)3, д)NaNO3?

1. а, б, в

2. б, в, г

3. в, г

4. б, д

5. а, в, г

Вопрос 4. С какими из перечисленных веществ будет взаимодействовать соляная кислота:

а)Fe, б)AgNO3, в)Na2SO4, г)Cu, д)Ca(OH)2?

1. а, б, д

2. б, в, г

3. а, д

4. б, в, д

5. а, б

Вопрос 5. Какие газы выделяются при взаимодействии меди с разбавленной H2SO4,

концентрированной H2SO4, разбавленной HNO3, концентрированной HNO3 при комнатной температуре?

1. H2, SO2, NH3, NO

2. -, SO2, NO, NO2

3. H2, H2S, N2, NO2

4. -, H2S, N2O, NO

5. -, SO2, N2, N2O

Задание 5.

Вопрос 1. Из числа предложенных солей выберите формулы сульфата, сульфита, сульфида,

гидросульфата: а)NaHSO3, б)LiHS, в)K2SO4, г)MgS, д)BaSO3, е)Na2S2O3, ж)KHSO4, з)Na2S2O8.

1. а, в, д, ж

2. б, г, е, з

3. в, г, д, ж

4. г, д, е, ж

5. а, д, ж, з

Вопрос 2. Какие из перечисленных кислот могут давать как средние, так и кислые соли:

а)HNO3, б)H2CO3, в)CH3COOH, г)H3PO4, д)HCl?

1. а, в, д

2. б, в

3. б, в, г

4. б, г

5. г, д

Вопрос 3. С какими из перечисленных веществ будет взаимодействовать растворенный сульфат

меди: а)Ag, б)HCl, в)Mg, г)Fe2O3, д)KOH?

1. а, б, д

2. в, д

3. б, в, д

4. в, г, д

5. б, д

Вопрос 4. С какими из перечисленных веществ будет взаимодействовать раствор хлорида

кальция: а)H2SO4, б)Fe, в)Na2CO3, г)SO2, д)Zn(OH)2?

1. б, в

2. а, б, г

3. а, в

4. а, б, в

5. в, д

Вопрос 5. Какие из приведенных солей будут разлагаться при нагревании с выделением газов:

а)CaCO3, б)K2CO3, в)K2SO4, г)Mg(NO3)2, д)LiClO4

1. а, б, г

2. б, в

3. в, г, д

4. а, г

5. г, д

Задание 6.

Вопрос 1. Укажите электролиты, которые диссоциируют ступенчато: а)Mg(OH)2, б)HCl,

в)MgCl2, г)H3PO4, д)Na3PO4, е)NaOH.

1. а, б, в

2. а, г

3. в, г, д

4. г, д, е

5. г, е

Вопрос 2. Какие из приведенных соединений являются сильными электолитами: а) CaCl2, б)H2O,

в)HNO3, г)KOH, д)H2CO3, е)Fe(OH)3, ж)CuSO4, з)CH3COOH

1. а, в, г, д

2. в, г, д, е

3. а, в, г, ж

4. в, г, д, ж

5. б, в, е, з

Вопрос 3. Расположите формулы гидроксидов в порядке возрастания их кислотных свойств:

а)H2SiO3, б)HClO4, в)H3PO4, г)H2SO4, д)Al(OH)3.

1. а, д, в, б, г

2. д, а, в, г, б

3. в, б, д, а, г

4. д, а, в, б, г

5. в, д, а, г, б

Вопрос 4. Какая из приведенных реакций в растворах электролитов идет до конца:

1. BaCl2+Na2SO4=BaSO4+2NaCl

2. CaCO3+HCl=CaCl2+H2O+CO2

3. Ca(OH)2+2HNO3=Ca(NO3)2+2H2O

4. Все реакции идут до конца

5. Ни одна не идет до конца

Вопрос 5. В растворах каких из приведенных солей, лакмус покраснеет: а)Al(NO3)3, б)KCl,

в)NH4Cl, г)Ba(NO3)2, д)Na2CO3?

1. а, в

2. а, б, в

3. в, г

4. в, г, д

5. б, в, г

Задание 7

Вопрос 1. Найдите в периодической системе элементы, имеющие следующие конфигурации

валентных электронов: 3d34s2; 5s2p3.

1. Cr, Sn

2. V, Sb

3. V, Nb

4. Nb, Sb

5. Nb, As

Вопрос 2. Какому атому принадлежит последний валентный электрон, имеющий следующий набор

квантовых чисел: n=3, l=1, ml=-1, ms=-1/2?

1. B

2. Al

3. S

4. P

5. Ar

Вопрос 3. Укажите вещества, молекулы которых имеют плоскую конфигурацию из-за sp2-

гибридизации центральных атомов: а)CH4, б)BCl3, в)H2SO4, г)SnCl2, д)C2H4.

1. а, б

2. б, г, д

3. г, д

4. б, в, г

5. б, д

Вопрос 4. Укажите вещества с ковалентной полярной связью: а)NO, б)N2, в)KCl, г)HS, д)OF2.

1. а, б, г

2. б, г

3. г, д

4. б, в, г

5. а, г, д

Вопрос 5. В каком из указанных соединений имеется ковалентная связь, образованная по

донорно-акцепторному механизму?

1. KNO3

2. NaCl

3. NH4Cl

4. CuCl2

5. HgSO4

Задание 8

Вопрос 1. Реакция какого типа всегда является окислительно-восстановительной?

1. реакция соединения (NH3+HCl=NH4Cl)

2. реакция разложения (CaCO3=CaO+CO2)

3. реакция обмена (HCl+KOH=KCl+H2O)

4. реакция замещения (Zn+CuCl2=Cu+ZnCl2)

5. реакция образования комплекса {Cu(OH)2+4NH3=[Cu(NH3)4](OH)2}

Вопрос 2. Расположите приведенные вещества в порядке возрастания степени окисления марганца:

а)KMnO4, б)Mn, в)MnO2, г)K2MnO4, д)MnO.

1. д, б, в, а, г

2. б, д, в, а, г

3. б, в, д, г, а

4. б, д, в, г, а

5. в, д, б, а,г

Вопрос 3. Какой из приведенных процессов является процессом восстановления:

1. As-3 As+3

2. Sn+4 Sn+2

3. Cr+3 Cr+6

4. S+4 S+6

5. N0 N+2

Вопрос 4. В какой из указанных реакций сера окисляется?

1. S+Zn ZnS

2. 2S+C CS2

3. S+O2 SO2

4. H2+S H2S

5. Fe+S FeS

Вопрос 5. Расставьте коэффициенты в уравнении: KMnO4+Na2SO3+H2SO4 K2SO4+Na2SO4+MnSO4+H2O.

Укажите сумму коэффициентов:

1. 19

2. 20

3. 23

4. 21

5. 25

Задание 9

Вопрос 1. Укажите, какой заряд имеет ион-комплексообразователь в следующем координационном

соединении - K[Pt(NH3)Cl5].

1. +3

2. +4

3. +5

4. +6

5. +7

Вопрос 2. В каком координационном соединении ион-комплексообразователь проявляет координационное

число равное 6?

1. [Cu(NH3)4]Cl2

2. K2[Cd(CN)4]

3. [Co(NH3)4Cl2]Cl

4. K2[Hg(CN)4]

5. Na2[Zn(CN)4]

Вопрос 3. Какое из комплексных соединений платины образует при диссоциации 3 свободных

аниона хлора?

1. [Pt(NH3)2Cl4]

2. [Pt(NH3)3Cl3]Cl

3. [Pt(NH3)4Cl2]

4. K2[PtCl6]

5. [Pt(NH3)5Cl]Cl3

Вопрос 4. В каком из комплексных соединений заряд комплексного иона равен –2?

1. K[AgCl2]

2. [Ag(NH3)2]Cl

3. K3[Fe(CN)6]

4. [Co(NH3)5NO2]Cl2

5. K2[Co(CSN)4]

Вопрос 5. Исходя из величины константы нестойкости (приложение 5), укажите, какой из

приведенных комплексных ионов является наиболее прочным?

1. [Ag(NH3)2]+

2. [Ni(CN)4]2-

3. [HgI4]2-

4. [HgBr4]2-

5. [HgCl4]2-

Задание 10

Вопрос 1. Пользуясь таблицей термодинамических характеристик некоторых веществ (приложение

2), рассчитайте энтальпии следующих реакций: а)CH4+2O2=CO2+2H2O, б)CH4+2H2O(г)= CO2+4H2.

Укажите эндо- или экзотермическими являются эти реакции.

1. обе экзотермические

2. обе эндотермические

3. а) эндотермическая, б) экзотермическая

4. а) экзотермическая, б) эндотермическая

5. нет правильного ответа

Вопрос 2. Не производя расчетов, определите знак изменения энтропии ( S) в следующих реакциях:

а)CH4(г)+H2O(г)=CO(г)+3H2(г), б)C2H5OH(ж)=C2H4(г)+H2O(г), в)N2(г)+3H2(г)=2NH3(г).

1. а) S>0, б) S<0, в) S<0

2. а) S>0, б) S>0, в) S<0

3. а) S<0, б) S<0, в) S>0

4. а) S<0, б) S>0, в) S>0

5. а) S>0, б) S>0, в) S>0

Вопрос 3. Пользуясь таблицей термодинамических характеристик определите изменение энергии

Гиббса химических реакций: а) 2Ca+O2=2CaO, б) 2CO+O2=2CO2, в) N2+O2=2NO при стандартных

условиях. Укажите знак изменения G .

1. а) G<0, б) G<0, в) G<0

2. а) G>0, б) G>0, в) G>0

3. а) G>0, б) G<0, в) G<0

4. а) G<0, б) G<0, в) G>0

5. а) G<0, б) G>0, в) G<0

Вопрос 4. Укажите, как изменится скорость химической реакции 2Н2+О2=2Н2О, если а)

концентрацию водорода увеличить в два раза, б) температуру реакции повысить на 300

(температурный коэффициент реакции =2).

1. а) увеличится в 2 раза, б) увеличится в 4 раза

2. а) увеличится в 4 раза, б) увеличится в 8 раз

3. а) уменьшится в 2 раза, б) увеличится в 6 раз

4. а) уменьшится в 4 раза, б) увеличится в 8 раз

5. а) увеличится в 4 раза, б) уменьшится в 6 раз

Вопрос 5. Укажите, в какую сторону сместиться равновесие реакции N2(г)+3H2(г)=2NH3(г), Н<0,

если а)увеличить в системе концентрацию аммиака, б) повысить температуру, в) увеличить давление

в системе?

1. а) , б) , в)

2. а) , б) , в)

3. а) , б) , в)

4. а) , б) , в)

5. а) , б) , в)

-----------------------------------------------------------------------------------------------

2 вариант

ХИМИЯ

Вопрос 1. Всякое чистое вещество, независимо от способов его получения и нахождения в

природе, имеет постоянный качественный и количественный состав.

1) Закон простых объемных отношений.

2) Закон Авогадро.

3) Закон постоянства состава.

4) Закон простых кратных отношений.

5) Закон эквивалентов.

Вопрос 2.Единица количества вещества -

1) Молекула

2) Атом

3) Эквивалент

4) Моль

5) Ион.

Вопрос 3. Валентный электронный слой атома галия - Ga:

1) 3s2p2

2) 3dl04s'

3) 4s2p'

4) 3d'4s2

5) 4s2p2

Вопрос 4. Квантовые числа, описывающие а) форму орбитали, б) направление электронных

облаков в пространстве:

1) a)l, б)/m I

2) а)n, б)l

3) а)m I , б) т S

4) а) п, б) m I

5) а)m I, б) l

КВАНТОВЫЕ ЧИСЛА - описывают состояние конкретного электрона в электронном облаке атома:

- ГЛАВНОЕ (n) - показывает, на каком электронном уровне, начиная от ближайшего к ядру

(1, 2, 3, ... ) находится данный электрон;

- ВСПОМОГАТЕЛЬНОЕ или ОРБИТАЛЬНОЕ (l) - показывает вид подуровня (s-подуровень, p-подуровень,

d-подуровень, f-подуровень);

- МАГНИТНОЕ (m) - указывает конкретную орбиталь (s-орбиталь, px-орбиталь, py-орбиталь и

т.д.);

- СПИНОВОЕ (s) - показывает, какое из двух возможных (разрешенных) состояний занимает электрон

на данной орбитали.

Вопрос 5. В молекуле какого из веществ, у центрального атома имеет место sp2 - гибридизация?

1) ВС13

2) С2Н2

3) ВеСl2

4) H2SO4

5) SF6

Обведено одна s и две р орбитали участвующие в образовании молекулы BCl3.

Вопрос 6. Связи расположены в порядке увеличения их прочности:

1) H-Cl, H-F, Н-Вг

2) H-F, H-C1, Н-Вг

3) H-Br, H-F, H-C1

4) H-Br, H-Cl, H-F

5) H-Cl, H-Br, H-F.

Вопрос 7. При абсолютном нуле энтропия всех тел равна 0.

1) Гесса

2) Периодический закон

3) Первый закон Закон термодинамики

4) Второй закон термодинамики

5) Третий закон термодинамики.

Значение аддитивной константы, возникающей при определении энтропии, устанавливается

теоремой Нернста, которую часто называют третьим законом термодинамики: энтропия любой

системы при абсолютном нуле температуры всегда может быть принята равной нулю

Вопрос 8. Тепловой эффект реакции Cu2++Mg° =Mg2++Cu° равен 534 кДж. Какое количество теплоты

выделится при восстановлении 12,8 г меди?

1) 1068 кДж

2) 10,68 кДж

3) 106,8 кДж

4) 213,6 кДж

5) 53,4 кДж

Число моль меди равно 12,6/64 = 0,2 моль. (64 –атомная масса меди) тогда если тепловой

эффект превращения 1 моль меди равен 534 кДж то в результате реакции 0,2 моль тепловой

эффект составит 534*0,2 = 106,8 кДж

Вопрос 9. Если концентрацию водорода уменьшить в 3 раза, то скорость реакции 2H2+O2=2H2O...

1) увеличится в 2 раза

2) увеличится в 9 раз

3) уменьшится в 3 раза

4) уменьшится в 9 раз

5) увеличится в 3 раза.

Скорость реакции выражается уравнением V = [H2]2[O2]. Тогда, если концентрацию водорода

уменьшить в 3 раза получим V=[1/3]2[1] = 0,11, то есть скорость составит 0,11 от начальной

или 1/0,11 = 9 раз.

Вопрос 10. В какую сторону сместится равновесие в системе Н2+I2=2НI; -АН, при а) увеличении

температуры, б) понижении концентрации HI?

Реакция экзотермична так как протекает с выделением тепла (-АН). Поэтому согласно

принципу Ле Шателье увеличение температуры сдвинет равновесие реакции в сторону реакции

идущей с поглощением тепла, то есть в сторону обратной реакции (влево). Понижение концентрации

HI приведет к сдвигу равновесия вправо, так как удаление продукта реакции всегда влечет за

собой сдвиг равновесие в сторону продуктов.

1) а) б)

2) а) б)

3) а) б)

4) а) б) ???????

5) а) б)

Вопрос 11. Какие из перечисленных реакций в растворах электролитов идут до конца?

1) ЗКОН+А1(ОН)3=К3[А1(ОН)6]

2) HNO3+NaOH=NaNO3+H2O

3) MgS+2HCl=H2S+MgCl2

4) Все выше перечисленные

5) Нет правильных ответов

Реакция 2) потому что в процессе реакции образуется малодиссоциирующее вещество (вода)

Реакция 3) потому что в ходе реакции выделяется газообразное вещество (сероводород)

Вопрос 12. Какая среда и каково значение рН в растворе, содержащем 5.10- 4 моль/л ионов Н+?

1) щелочная, рН=3, 30

2) кислая, рН=4,70

3) щелочная, рН=4,70

4) нейтральная, рН=7

5) кислая, рН=3,30

рН рассчитывается по уравнению рН=-log[H+] = -log 5.10- 4 = 3,30. рН меньше 7 поэтому

среда кислая

Вопрос 13. Какова степень окисления кислорода в Н2О2? Чем может являться пероксид водорода

в окислительно-восстановительных реакциях?

1) -2, восстановитель

2) -1, окислитель и восстановитель

3) -2, восстановитель и окислитель

4) — 1, восстановитель

5) +2, окислитель.

Вопрос 14. Укажите продукты электролиза раствора Pb(NO3)2: 1)Н2, О2

2) Pb, N2, O2

3) Н2, РЬ(ОН)2

4) Pb, O2, HNO3

5) Н2, Pb(OH)2, HNO3, O2.

Вопрос 15. Укажите продукты коррозии контакта Mg-Cu в нейтральной среде: l)Mg2+ , Н2

2) Си2+, Н2

3) Mg(OH)2

4) Cu(OH)2

5) Mg(OH)2, H2.

Схема гальванической пары Mg / O2 , H2O / Cu ,

анод (Mg): Mg0  2 = Mg2+,

катод (Cu): O2 + 2H2O + 4 = 4OH–,

Суммарная реакция и продукт: Mg2+ + 2OH– = Mg(OH)2.

Вопрос 16. В какой строке под пунктом а) находится металл, растворяющейся в концентрированной

HNO3, под пунктом б) металл, растворяющийся в КОН? Составьте уравнения реакций.

1) а) Аи, б)Сг

2) а) Си, б) Аи

3) а) Си, б)Сг

4) а)Сг, б) Си

5) а) Аи, б) Си

Сu + 3HNO3(конц) = Cu(NO3)2 + NO2 +H2O

2Cr + 2KOH +6H2O = 2K[Cr(OH)4] + 3H2

Вопрос 17. В уравнении полуреакции МпО2+4ОН-... МпО4- +2Н2О количество отданных

(принятых) электронов равно..., МпО2 является...

1) +3 е-, восстановителем

2) —Зе-, восстановителем

3) +2е-, окислителем

4) -2е-, восстановителем

5) +3е-, окислителем.

Вопорс18. Координационное число и заряд иона-комплексообразователя в соединении

[Pt(NH3)4Cl2] соответственно равны:

1) 2,+2

2) 3, +4

3) 6, +3

4) 6,+6

5) 6, +2

Добавить документ в свой блог или на сайт

Похожие:

Вопрос Какие из приведенных соединений относятся к основным оксидам: а no, б MgO, в BaO2, г Na2O, д Mn2O7? iconТест 200 к какому классу соединений относится тирозин 1 аминокислота
Укажите, какие из перечисленных соединений относятся к по­верхностно-активным веществам

Вопрос Какие из приведенных соединений относятся к основным оксидам: а no, б MgO, в BaO2, г Na2O, д Mn2O7? iconВопрос №1. Какая страна была взята за образец при развитии и становлении...
Вопрос №2. К какой группе кредитных институтов относятся благотворительные фонды?

Вопрос Какие из приведенных соединений относятся к основным оксидам: а no, б MgO, в BaO2, г Na2O, д Mn2O7? iconВопрос Что такое доу?
Вопрос Какие положения содержатся в разделе "Документирование управленческой деятельности" гсдоу?

Вопрос Какие из приведенных соединений относятся к основным оксидам: а no, б MgO, в BaO2, г Na2O, д Mn2O7? iconВопрос Как переводится с греческого слово «философия»?
Вопрос Какие из перечисленных ниже разделов философии называются философскими

Вопрос Какие из приведенных соединений относятся к основным оксидам: а no, б MgO, в BaO2, г Na2O, д Mn2O7? iconВопрос Определите понятие «Связи с общественностью». Что это?
Вопрос Какие методы изучения общественного мнения можно считать социологическими?

Вопрос Какие из приведенных соединений относятся к основным оксидам: а no, б MgO, в BaO2, г Na2O, д Mn2O7? iconВопрос № Какие законы философии используются в экономической науке?
Вопрос № Какой метод предполагает анализ практической деятельности человека, базирующийся на принципах

Вопрос Какие из приведенных соединений относятся к основным оксидам: а no, б MgO, в BaO2, г Na2O, д Mn2O7? iconВопрос Когда возможна полноценная интеграция России в мировую экономику?
Вопрос Какие задачи не нужно решить, чтобы повысить стоимостной объем российского

Вопрос Какие из приведенных соединений относятся к основным оксидам: а no, б MgO, в BaO2, г Na2O, д Mn2O7? iconВопрос №1. Какой ученый относил к понятию труд "только тягостные усилия"?
Вопрос №4. Какие факторы являются объективной основой для определения заработной платы?

Вопрос Какие из приведенных соединений относятся к основным оксидам: а no, б MgO, в BaO2, г Na2O, д Mn2O7? iconВ чем состоит отличие недвижимости от движимого имущества. Какие...
Сравнительный подход. Методы. Какие основные единицы сравнения используются в сравнительном подходе. Назовите основные критерии применения...

Вопрос Какие из приведенных соединений относятся к основным оксидам: а no, б MgO, в BaO2, г Na2O, д Mn2O7? iconВопрос №1. Как называется система ставок, по которым предприятия...
Вопрос №2. Какие из рыночных цен складываются под влиянием спроса и предложения в условиях свободной конкуренции?

Вы можете разместить ссылку на наш сайт:
Школьные материалы


При копировании материала укажите ссылку © 2013
контакты
zadocs.ru
Главная страница

Разработка сайта — Веб студия Адаманов